C20H24ClNO4 — CID 45039002
diethyl 2-(6-chloro-2,3,4,9-tetrahydro-1H-carbazol-2-yl)-2-(trideuteriomethyl)propanedioate (PubChem CID 45039002) has the molecular formula C20H24ClNO4 and a molecular weight of 380.89 g/mol. Its IUPAC name is diethyl 2-(6-chloro-2,3,4,9-tetrahydro-1H-carbazol-2-yl)-2-(trideuteriomethyl)propanedioate.
| Compound Name | diethyl 2-(6-chloro-2,3,4,9-tetrahydro-1H-carbazol-2-yl)-2-(trideuteriomethyl)propanedioate |
|---|---|
| PubChem CID | 45039002 |
| Molecular Formula | C20H24ClNO4 |
| Molecular Weight | 380.89 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | diethyl 2-(6-chloro-2,3,4,9-tetrahydro-1H-carbazol-2-yl)-2-(trideuteriomethyl)propanedioate |
| SMILES | [2H]C([2H])([2H])C(C(=O)OCC)(C(=O)OCC)C1CCc2c([nH]c3ccc(Cl)cc23)C1 |
| InChI | InChI=1S/C20H24ClNO4/c1-4-25-18(23)20(3,19(24)26-5-2)12-6-8-14-15-11-13(21)7-9-16(15)22-17(14)10-12/h7,9,11-12,22H,4-6,8,10H2,1-3H3/i3D3 |
| InChIKey | XWJZVIIPTMHYNQ-HPRDVNIFSA-N |
| XLogP | 4.06 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.89 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|