C37H46N2O6 — CID 23337490
bis[3-(6-hydroxy-2,3,4,9-tetrahydro-1H-carbazol-2-yl)pentan-3-yl] propanedioate (PubChem CID 23337490) has the molecular formula C37H46N2O6 and a molecular weight of 614.78 g/mol. Its IUPAC name is bis[3-(6-hydroxy-2,3,4,9-tetrahydro-1H-carbazol-2-yl)pentan-3-yl] propanedioate.
| Compound Name | bis[3-(6-hydroxy-2,3,4,9-tetrahydro-1H-carbazol-2-yl)pentan-3-yl] propanedioate |
|---|---|
| PubChem CID | 23337490 |
| Molecular Formula | C37H46N2O6 |
| Molecular Weight | 614.78 g/mol |
| Exact Mass | 614.34 |
| IUPAC Name | bis[3-(6-hydroxy-2,3,4,9-tetrahydro-1H-carbazol-2-yl)pentan-3-yl] propanedioate |
| SMILES | CCC(CC)(OC(=O)CC(=O)OC(CC)(CC)C1CCc2c([nH]c3ccc(O)cc23)C1)C1CCc2c([nH]c3ccc(O)cc23)C1 |
| InChI | InChI=1S/C37H46N2O6/c1-5-36(6-2,22-9-13-26-28-19-24(40)11-15-30(28)38-32(26)17-22)44-34(42)21-35(43)45-37(7-3,8-4)23-10-14-27-29-20-25(41)12-16-31(29)39-33(27)18-23/h11-12,15-16,19-20,22-23,38-41H,5-10,13-14,17-18,21H2,1-4H3 |
| InChIKey | JSZDONPJCIBVAE-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 124.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.78 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|