C21H21ClN2O2 — CID 84580341
2-(4-chlorophenoxy)-N-(6-methyl-2,3,4,9-tetrahydro-1H-carbazol-2-yl)acetamide (PubChem CID 84580341) has the molecular formula C21H21ClN2O2 and a molecular weight of 368.86 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-(6-methyl-2,3,4,9-tetrahydro-1H-carbazol-2-yl)acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-(6-methyl-2,3,4,9-tetrahydro-1H-carbazol-2-yl)acetamide |
|---|---|
| PubChem CID | 84580341 |
| Molecular Formula | C21H21ClN2O2 |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-(6-methyl-2,3,4,9-tetrahydro-1H-carbazol-2-yl)acetamide |
| SMILES | Cc1ccc2[nH]c3c(c2c1)CCC(NC(=O)COc1ccc(Cl)cc1)C3 |
| InChI | InChI=1S/C21H21ClN2O2/c1-13-2-9-19-18(10-13)17-8-5-15(11-20(17)24-19)23-21(25)12-26-16-6-3-14(22)4-7-16/h2-4,6-7,9-10,15,24H,5,8,11-12H2,1H3,(H,23,25) |
| InChIKey | YVIOJSHNQPFEQL-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|