C13H12F3N3O2 — CID 117262896
3-pyrrolidin-2-yl-7-(trifluoromethyl)-1H-quinazoline-2,4-dione (PubChem CID 117262896) has the molecular formula C13H12F3N3O2 and a molecular weight of 299.25 g/mol. Its IUPAC name is 3-pyrrolidin-2-yl-7-(trifluoromethyl)-1H-quinazoline-2,4-dione.
| Compound Name | 3-pyrrolidin-2-yl-7-(trifluoromethyl)-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 117262896 |
| Molecular Formula | C13H12F3N3O2 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 3-pyrrolidin-2-yl-7-(trifluoromethyl)-1H-quinazoline-2,4-dione |
| SMILES | O=c1[nH]c2cc(C(F)(F)F)ccc2c(=O)n1C1CCCN1 |
| InChI | InChI=1S/C13H12F3N3O2/c14-13(15,16)7-3-4-8-9(6-7)18-12(21)19(11(8)20)10-2-1-5-17-10/h3-4,6,10,17H,1-2,5H2,(H,18,21) |
| InChIKey | RTAYXZQBFXUPEG-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |