C13H15N3O3 — CID 117262827
7-hydroxy-3-piperidin-3-yl-1H-quinazoline-2,4-dione (PubChem CID 117262827) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is 7-hydroxy-3-piperidin-3-yl-1H-quinazoline-2,4-dione.
| Compound Name | 7-hydroxy-3-piperidin-3-yl-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 117262827 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 7-hydroxy-3-piperidin-3-yl-1H-quinazoline-2,4-dione |
| SMILES | O=c1[nH]c2cc(O)ccc2c(=O)n1C1CCCNC1 |
| InChI | InChI=1S/C13H15N3O3/c17-9-3-4-10-11(6-9)15-13(19)16(12(10)18)8-2-1-5-14-7-8/h3-4,6,8,14,17H,1-2,5,7H2,(H,15,19) |
| InChIKey | XJOQMIDVOCYOOJ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 87.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |