C21H29N3O — CID 71070480
13-cyclohexyl-4-methoxy-10-methyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene (PubChem CID 71070480) has the molecular formula C21H29N3O and a molecular weight of 339.48 g/mol. Its IUPAC name is 13-cyclohexyl-4-methoxy-10-methyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene.
| Compound Name | 13-cyclohexyl-4-methoxy-10-methyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene |
|---|---|
| PubChem CID | 71070480 |
| Molecular Formula | C21H29N3O |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.23 |
| IUPAC Name | 13-cyclohexyl-4-methoxy-10-methyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene |
| SMILES | COc1ccc2[nH]c3c(c2c1)CC1CN(C2CCCCC2)CN1C3C |
| InChI | InChI=1S/C21H29N3O/c1-14-21-19(18-11-17(25-2)8-9-20(18)22-21)10-16-12-23(13-24(14)16)15-6-4-3-5-7-15/h8-9,11,14-16,22H,3-7,10,12-13H2,1-2H3 |
| InChIKey | DCHAVGCXOSJVDR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 31.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|