C16H21FN2 — CID 84638269
2-[(5-fluoro-2-methyl-1H-indol-3-yl)methyl]cyclohexan-1-amine (PubChem CID 84638269) has the molecular formula C16H21FN2 and a molecular weight of 260.36 g/mol. Its IUPAC name is 2-[(5-fluoro-2-methyl-1H-indol-3-yl)methyl]cyclohexan-1-amine.
| Compound Name | 2-[(5-fluoro-2-methyl-1H-indol-3-yl)methyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 84638269 |
| Molecular Formula | C16H21FN2 |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | 2-[(5-fluoro-2-methyl-1H-indol-3-yl)methyl]cyclohexan-1-amine |
| SMILES | Cc1[nH]c2ccc(F)cc2c1CC1CCCCC1N |
| InChI | InChI=1S/C16H21FN2/c1-10-13(8-11-4-2-3-5-15(11)18)14-9-12(17)6-7-16(14)19-10/h6-7,9,11,15,19H,2-5,8,18H2,1H3 |
| InChIKey | AICLSZVTVHLODM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|