C24H17Cl2NO5 — CID 4905865
N-[3-(3,4-dichlorophenyl)-4-oxochromen-2-yl]-3,4-dimethoxybenzamide (PubChem CID 4905865) has the molecular formula C24H17Cl2NO5 and a molecular weight of 470.31 g/mol. Its IUPAC name is N-[3-(3,4-dichlorophenyl)-4-oxochromen-2-yl]-3,4-dimethoxybenzamide.
| Compound Name | N-[3-(3,4-dichlorophenyl)-4-oxochromen-2-yl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 4905865 |
| Molecular Formula | C24H17Cl2NO5 |
| Molecular Weight | 470.31 g/mol |
| Exact Mass | 469.05 |
| IUPAC Name | N-[3-(3,4-dichlorophenyl)-4-oxochromen-2-yl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2oc3ccccc3c(=O)c2-c2ccc(Cl)c(Cl)c2)cc1OC |
| InChI | InChI=1S/C24H17Cl2NO5/c1-30-19-10-8-14(12-20(19)31-2)23(29)27-24-21(13-7-9-16(25)17(26)11-13)22(28)15-5-3-4-6-18(15)32-24/h3-12H,1-2H3,(H,27,29) |
| InChIKey | MOVMHZWJNOUOGF-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.31 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |