C23H16FNO4 — CID 7678084
4-fluoro-N-[3-(4-methoxyphenyl)-4-oxochromen-2-yl]benzamide (PubChem CID 7678084) has the molecular formula C23H16FNO4 and a molecular weight of 389.38 g/mol. Its IUPAC name is 4-fluoro-N-[3-(4-methoxyphenyl)-4-oxochromen-2-yl]benzamide.
| Compound Name | 4-fluoro-N-[3-(4-methoxyphenyl)-4-oxochromen-2-yl]benzamide |
|---|---|
| PubChem CID | 7678084 |
| Molecular Formula | C23H16FNO4 |
| Molecular Weight | 389.38 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 4-fluoro-N-[3-(4-methoxyphenyl)-4-oxochromen-2-yl]benzamide |
| SMILES | COc1ccc(-c2c(NC(=O)c3ccc(F)cc3)oc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C23H16FNO4/c1-28-17-12-8-14(9-13-17)20-21(26)18-4-2-3-5-19(18)29-23(20)25-22(27)15-6-10-16(24)11-7-15/h2-13H,1H3,(H,25,27) |
| InChIKey | VMEIEXBBQICDPZ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.38 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |