C21H15NO3S — CID 4870395
N-[3-(4-methylphenyl)-4-oxochromen-2-yl]thiophene-2-carboxamide (PubChem CID 4870395) has the molecular formula C21H15NO3S and a molecular weight of 361.42 g/mol. Its IUPAC name is N-[3-(4-methylphenyl)-4-oxochromen-2-yl]thiophene-2-carboxamide.
| Compound Name | N-[3-(4-methylphenyl)-4-oxochromen-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 4870395 |
| Molecular Formula | C21H15NO3S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | N-[3-(4-methylphenyl)-4-oxochromen-2-yl]thiophene-2-carboxamide |
| SMILES | Cc1ccc(-c2c(NC(=O)c3cccs3)oc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C21H15NO3S/c1-13-8-10-14(11-9-13)18-19(23)15-5-2-3-6-16(15)25-21(18)22-20(24)17-7-4-12-26-17/h2-12H,1H3,(H,22,24) |
| InChIKey | SYERLOCAOJRPRS-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |