C20H11Cl2NO3S — CID 4975081
N-[3-(3,4-dichlorophenyl)-4-oxochromen-2-yl]thiophene-2-carboxamide (PubChem CID 4975081) has the molecular formula C20H11Cl2NO3S and a molecular weight of 416.29 g/mol. Its IUPAC name is N-[3-(3,4-dichlorophenyl)-4-oxochromen-2-yl]thiophene-2-carboxamide.
| Compound Name | N-[3-(3,4-dichlorophenyl)-4-oxochromen-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 4975081 |
| Molecular Formula | C20H11Cl2NO3S |
| Molecular Weight | 416.29 g/mol |
| Exact Mass | 414.98 |
| IUPAC Name | N-[3-(3,4-dichlorophenyl)-4-oxochromen-2-yl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1oc2ccccc2c(=O)c1-c1ccc(Cl)c(Cl)c1)c1cccs1 |
| InChI | InChI=1S/C20H11Cl2NO3S/c21-13-8-7-11(10-14(13)22)17-18(24)12-4-1-2-5-15(12)26-20(17)23-19(25)16-6-3-9-27-16/h1-10H,(H,23,25) |
| InChIKey | KYHSKQFPDXDUTB-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.29 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |