C23H15Cl3N2O2 — CID 4911005
2-chloro-N-[3-(3,4-dichlorophenyl)-1-methyl-4-oxoquinolin-2-yl]benzamide (PubChem CID 4911005) has the molecular formula C23H15Cl3N2O2 and a molecular weight of 457.74 g/mol. Its IUPAC name is 2-chloro-N-[3-(3,4-dichlorophenyl)-1-methyl-4-oxoquinolin-2-yl]benzamide.
| Compound Name | 2-chloro-N-[3-(3,4-dichlorophenyl)-1-methyl-4-oxoquinolin-2-yl]benzamide |
|---|---|
| PubChem CID | 4911005 |
| Molecular Formula | C23H15Cl3N2O2 |
| Molecular Weight | 457.74 g/mol |
| Exact Mass | 456.02 |
| IUPAC Name | 2-chloro-N-[3-(3,4-dichlorophenyl)-1-methyl-4-oxoquinolin-2-yl]benzamide |
| SMILES | Cn1c(NC(=O)c2ccccc2Cl)c(-c2ccc(Cl)c(Cl)c2)c(=O)c2ccccc21 |
| InChI | InChI=1S/C23H15Cl3N2O2/c1-28-19-9-5-3-7-15(19)21(29)20(13-10-11-17(25)18(26)12-13)22(28)27-23(30)14-6-2-4-8-16(14)24/h2-12H,1H3,(H,27,30) |
| InChIKey | YSISBJYBJIDRJT-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.74 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |