C25H30FN2O3+ — CID 7463114
dibutyl-[2-[[3-(4-fluorophenyl)-4-oxochromen-2-yl]amino]-2-oxoethyl]azanium (PubChem CID 7463114) has the molecular formula C25H30FN2O3+ and a molecular weight of 425.52 g/mol. Its IUPAC name is dibutyl-[2-[[3-(4-fluorophenyl)-4-oxochromen-2-yl]amino]-2-oxoethyl]azanium.
| Compound Name | dibutyl-[2-[[3-(4-fluorophenyl)-4-oxochromen-2-yl]amino]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 7463114 |
| Molecular Formula | C25H30FN2O3+ |
| Molecular Weight | 425.52 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | dibutyl-[2-[[3-(4-fluorophenyl)-4-oxochromen-2-yl]amino]-2-oxoethyl]azanium |
| SMILES | CCCC[NH+](CCCC)CC(=O)Nc1oc2ccccc2c(=O)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C25H29FN2O3/c1-3-5-15-28(16-6-4-2)17-22(29)27-25-23(18-11-13-19(26)14-12-18)24(30)20-9-7-8-10-21(20)31-25/h7-14H,3-6,15-17H2,1-2H3,(H,27,29)/p+1 |
| InChIKey | XKYKKTDPUUKGSR-UHFFFAOYSA-O |
| XLogP | 4.02 |
| TPSA | 63.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.52 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |