C21H14N2O3 — CID 132849199
13-(4-methoxyphenyl)-8-oxa-11,17-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,12,14,16-heptaen-9-one (PubChem CID 132849199) has the molecular formula C21H14N2O3 and a molecular weight of 342.35 g/mol. Its IUPAC name is 13-(4-methoxyphenyl)-8-oxa-11,17-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,12,14,16-heptaen-9-one.
| Compound Name | 13-(4-methoxyphenyl)-8-oxa-11,17-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,12,14,16-heptaen-9-one |
|---|---|
| PubChem CID | 132849199 |
| Molecular Formula | C21H14N2O3 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 13-(4-methoxyphenyl)-8-oxa-11,17-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,12,14,16-heptaen-9-one |
| SMILES | COc1ccc(-c2ccc3nc4c5ccccc5oc(=O)c4n3c2)cc1 |
| InChI | InChI=1S/C21H14N2O3/c1-25-15-9-6-13(7-10-15)14-8-11-18-22-19-16-4-2-3-5-17(16)26-21(24)20(19)23(18)12-14/h2-12H,1H3 |
| InChIKey | OCNSIVHQJNDDCL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|