About 3-phenyl-1H-chromeno[4,3-b]pyrrol-4-one
3-phenyl-1H-chromeno[4,3-b]pyrrol-4-one (PubChem CID 15419530) has the molecular formula C17H11NO2
and a molecular weight of 261.28 g/mol. Its IUPAC name is 3-phenyl-1H-chromeno[4,3-b]pyrrol-4-one.
Molecular Properties
| Compound Name | 3-phenyl-1H-chromeno[4,3-b]pyrrol-4-one |
| PubChem CID | 15419530 |
| Molecular Formula | C17H11NO2 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 3-phenyl-1H-chromeno[4,3-b]pyrrol-4-one |
| SMILES | O=c1oc2ccccc2c2[nH]cc(-c3ccccc3)c12 |
| InChI | InChI=1S/C17H11NO2/c19-17-15-13(11-6-2-1-3-7-11)10-18-16(15)12-8-4-5-9-14(12)20-17/h1-10,18H |
| InChIKey | HAPXNXZZMBATRV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-phenyl-1H-chromeno[4,3-b]pyrrol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-1H-chromeno[4,3-b]pyrrol-4-one?
The IUPAC name of 3-phenyl-1H-chromeno[4,3-b]pyrrol-4-one (CID 15419530) is 3-phenyl-1H-chromeno[4,3-b]pyrrol-4-one.
What is the SMILES notation for 3-phenyl-1H-chromeno[4,3-b]pyrrol-4-one?
The canonical SMILES for 3-phenyl-1H-chromeno[4,3-b]pyrrol-4-one is O=c1oc2ccccc2c2[nH]cc(-c3ccccc3)c12.
What is the InChIKey of 3-phenyl-1H-chromeno[4,3-b]pyrrol-4-one?
The InChIKey is HAPXNXZZMBATRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11NO2/c19-17-15-13(11-6-2-1-3-7-11)10-18-16(15)12-8-4-5-9-14(12)20-17/h1-10,18H.
What are the key properties of 3-phenyl-1H-chromeno[4,3-b]pyrrol-4-one?
3-phenyl-1H-chromeno[4,3-b]pyrrol-4-one has a molecular weight of 261.28 g/mol, XLogP of 3.94, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-1H-chromeno[4,3-b]pyrrol-4-one is sourced from PubChem (CID 15419530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).