C18H13F3O4 — CID 167299955
1-hydroxy-9-propyl-2-(2,2,2-trifluoroacetyl)benzo[f]chromen-3-one (PubChem CID 167299955) has the molecular formula C18H13F3O4 and a molecular weight of 350.29 g/mol. Its IUPAC name is 1-hydroxy-9-propyl-2-(2,2,2-trifluoroacetyl)benzo[f]chromen-3-one.
| Compound Name | 1-hydroxy-9-propyl-2-(2,2,2-trifluoroacetyl)benzo[f]chromen-3-one |
|---|---|
| PubChem CID | 167299955 |
| Molecular Formula | C18H13F3O4 |
| Molecular Weight | 350.29 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 1-hydroxy-9-propyl-2-(2,2,2-trifluoroacetyl)benzo[f]chromen-3-one |
| SMILES | CCCc1ccc2ccc3oc(=O)c(C(=O)C(F)(F)F)c(O)c3c2c1 |
| InChI | InChI=1S/C18H13F3O4/c1-2-3-9-4-5-10-6-7-12-13(11(10)8-9)15(22)14(17(24)25-12)16(23)18(19,20)21/h4-8,22H,2-3H2,1H3 |
| InChIKey | YZJNIFAJDPNDBY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.29 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|