C13H9ClF3NO3 — CID 123294448
4-chloro-7-(dimethylamino)-3-(2,2,2-trifluoroacetyl)chromen-2-one (PubChem CID 123294448) has the molecular formula C13H9ClF3NO3 and a molecular weight of 319.67 g/mol. Its IUPAC name is 4-chloro-7-(dimethylamino)-3-(2,2,2-trifluoroacetyl)chromen-2-one.
| Compound Name | 4-chloro-7-(dimethylamino)-3-(2,2,2-trifluoroacetyl)chromen-2-one |
|---|---|
| PubChem CID | 123294448 |
| Molecular Formula | C13H9ClF3NO3 |
| Molecular Weight | 319.67 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 4-chloro-7-(dimethylamino)-3-(2,2,2-trifluoroacetyl)chromen-2-one |
| SMILES | CN(C)c1ccc2c(Cl)c(C(=O)C(F)(F)F)c(=O)oc2c1 |
| InChI | InChI=1S/C13H9ClF3NO3/c1-18(2)6-3-4-7-8(5-6)21-12(20)9(10(7)14)11(19)13(15,16)17/h3-5H,1-2H3 |
| InChIKey | DTJAGQSMAJEXHJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.67 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|