C23H18O9 — CID 87782624
3-(4-hydroxy-8-methoxy-2-oxochromen-3-yl)-2,6-dimethoxy-2,3-dihydrofuro[3,2-c]chromen-4-one (PubChem CID 87782624) has the molecular formula C23H18O9 and a molecular weight of 438.39 g/mol. Its IUPAC name is 3-(4-hydroxy-8-methoxy-2-oxochromen-3-yl)-2,6-dimethoxy-2,3-dihydrofuro[3,2-c]chromen-4-one.
| Compound Name | 3-(4-hydroxy-8-methoxy-2-oxochromen-3-yl)-2,6-dimethoxy-2,3-dihydrofuro[3,2-c]chromen-4-one |
|---|---|
| PubChem CID | 87782624 |
| Molecular Formula | C23H18O9 |
| Molecular Weight | 438.39 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | 3-(4-hydroxy-8-methoxy-2-oxochromen-3-yl)-2,6-dimethoxy-2,3-dihydrofuro[3,2-c]chromen-4-one |
| SMILES | COc1cccc2c(O)c(C3c4c(c5cccc(OC)c5oc4=O)OC3OC)c(=O)oc12 |
| InChI | InChI=1S/C23H18O9/c1-27-12-8-4-6-10-17(24)15(21(25)30-18(10)12)14-16-20(32-23(14)29-3)11-7-5-9-13(28-2)19(11)31-22(16)26/h4-9,14,23-24H,1-3H3 |
| InChIKey | LZCOKUAFKVUYSG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 117.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|