C22H14O8 — CID 58668704
2-(4-hydroxy-8-methoxy-2-oxochromen-3-yl)-6-methoxyfuro[3,2-c]chromen-4-one (PubChem CID 58668704) has the molecular formula C22H14O8 and a molecular weight of 406.35 g/mol. Its IUPAC name is 2-(4-hydroxy-8-methoxy-2-oxochromen-3-yl)-6-methoxyfuro[3,2-c]chromen-4-one.
| Compound Name | 2-(4-hydroxy-8-methoxy-2-oxochromen-3-yl)-6-methoxyfuro[3,2-c]chromen-4-one |
|---|---|
| PubChem CID | 58668704 |
| Molecular Formula | C22H14O8 |
| Molecular Weight | 406.35 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | 2-(4-hydroxy-8-methoxy-2-oxochromen-3-yl)-6-methoxyfuro[3,2-c]chromen-4-one |
| SMILES | COc1cccc2c(O)c(-c3cc4c(=O)oc5c(OC)cccc5c4o3)c(=O)oc12 |
| InChI | InChI=1S/C22H14O8/c1-26-13-7-3-5-10-17(23)16(22(25)30-19(10)13)15-9-12-18(28-15)11-6-4-8-14(27-2)20(11)29-21(12)24/h3-9,23H,1-2H3 |
| InChIKey | PDAGJEJFMHXPMZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 112.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.35 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|