C20H10O8 — CID 140850447
2-(4,6,7-trihydroxy-2-oxochromen-3-yl)furo[3,2-c]chromen-4-one (PubChem CID 140850447) has the molecular formula C20H10O8 and a molecular weight of 378.29 g/mol. Its IUPAC name is 2-(4,6,7-trihydroxy-2-oxochromen-3-yl)furo[3,2-c]chromen-4-one.
| Compound Name | 2-(4,6,7-trihydroxy-2-oxochromen-3-yl)furo[3,2-c]chromen-4-one |
|---|---|
| PubChem CID | 140850447 |
| Molecular Formula | C20H10O8 |
| Molecular Weight | 378.29 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | 2-(4,6,7-trihydroxy-2-oxochromen-3-yl)furo[3,2-c]chromen-4-one |
| SMILES | O=c1oc2cc(O)c(O)cc2c(O)c1-c1cc2c(=O)oc3ccccc3c2o1 |
| InChI | InChI=1S/C20H10O8/c21-11-5-9-14(7-12(11)22)28-20(25)16(17(9)23)15-6-10-18(26-15)8-3-1-2-4-13(8)27-19(10)24/h1-7,21-23H |
| InChIKey | MHANIVWLTDRJDO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 134.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.29 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|