C20H10O6 — CID 11198778
8-hydroxy-3-methoxy-18-oxapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2(7),3,5,8,12(20),13,15-octaene-10,11,17-trione (PubChem CID 11198778) has the molecular formula C20H10O6 and a molecular weight of 346.29 g/mol. Its IUPAC name is 8-hydroxy-3-methoxy-18-oxapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2(7),3,5,8,12(20),13,15-octaene-10,11,17-trione.
| Compound Name | 8-hydroxy-3-methoxy-18-oxapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2(7),3,5,8,12(20),13,15-octaene-10,11,17-trione |
|---|---|
| PubChem CID | 11198778 |
| Molecular Formula | C20H10O6 |
| Molecular Weight | 346.29 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | 8-hydroxy-3-methoxy-18-oxapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2(7),3,5,8,12(20),13,15-octaene-10,11,17-trione |
| SMILES | COc1cccc2c(O)c3c(=O)c(=O)c4cccc5c(=O)oc(c12)c3c54 |
| InChI | InChI=1S/C20H10O6/c1-25-11-7-3-5-9-13(11)19-14-12-8(4-2-6-10(12)20(24)26-19)17(22)18(23)15(14)16(9)21/h2-7,21H,1H3 |
| InChIKey | AAPQTUXCVOWKKU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.29 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|