C30H20O7 — CID 87782102
15-ethoxy-14-(1-hydroxy-3-oxoxanthen-2-yl)-11,16-dioxatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,8,13(17)-hexaen-12-one (PubChem CID 87782102) has the molecular formula C30H20O7 and a molecular weight of 492.48 g/mol. Its IUPAC name is 15-ethoxy-14-(1-hydroxy-3-oxoxanthen-2-yl)-11,16-dioxatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,8,13(17)-hexaen-12-one.
| Compound Name | 15-ethoxy-14-(1-hydroxy-3-oxoxanthen-2-yl)-11,16-dioxatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,8,13(17)-hexaen-12-one |
|---|---|
| PubChem CID | 87782102 |
| Molecular Formula | C30H20O7 |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | 15-ethoxy-14-(1-hydroxy-3-oxoxanthen-2-yl)-11,16-dioxatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,8,13(17)-hexaen-12-one |
| SMILES | CCOC1Oc2c(c(=O)oc3ccc4ccccc4c23)C1c1c(O)c2cc3ccccc3oc-2cc1=O |
| InChI | InChI=1S/C30H20O7/c1-2-34-30-25(24-19(31)14-22-18(27(24)32)13-16-8-4-6-10-20(16)35-22)26-28(37-30)23-17-9-5-3-7-15(17)11-12-21(23)36-29(26)33/h3-14,25,30,32H,2H2,1H3 |
| InChIKey | LEJPEGDQEVNQTK-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 99.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|