C16H16N2O3 — CID 171804142
3-(3-ethoxypropyl)chromeno[3,4-b]pyrazin-5-one (PubChem CID 171804142) has the molecular formula C16H16N2O3 and a molecular weight of 284.31 g/mol. Its IUPAC name is 3-(3-ethoxypropyl)chromeno[3,4-b]pyrazin-5-one.
| Compound Name | 3-(3-ethoxypropyl)chromeno[3,4-b]pyrazin-5-one |
|---|---|
| PubChem CID | 171804142 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 3-(3-ethoxypropyl)chromeno[3,4-b]pyrazin-5-one |
| SMILES | CCOCCCc1cnc2c(n1)c(=O)oc1ccccc12 |
| InChI | InChI=1S/C16H16N2O3/c1-2-20-9-5-6-11-10-17-14-12-7-3-4-8-13(12)21-16(19)15(14)18-11/h3-4,7-8,10H,2,5-6,9H2,1H3 |
| InChIKey | QFYICXQJIXXLNT-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|