C26H29N3O3 — CID 171804118
3-[3-[butyl-[(3-methoxyphenyl)methyl]amino]propyl]chromeno[3,4-b]pyrazin-5-one (PubChem CID 171804118) has the molecular formula C26H29N3O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is 3-[3-[butyl-[(3-methoxyphenyl)methyl]amino]propyl]chromeno[3,4-b]pyrazin-5-one.
| Compound Name | 3-[3-[butyl-[(3-methoxyphenyl)methyl]amino]propyl]chromeno[3,4-b]pyrazin-5-one |
|---|---|
| PubChem CID | 171804118 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 3-[3-[butyl-[(3-methoxyphenyl)methyl]amino]propyl]chromeno[3,4-b]pyrazin-5-one |
| SMILES | CCCCN(CCCc1cnc2c(n1)c(=O)oc1ccccc12)Cc1cccc(OC)c1 |
| InChI | InChI=1S/C26H29N3O3/c1-3-4-14-29(18-19-9-7-11-21(16-19)31-2)15-8-10-20-17-27-24-22-12-5-6-13-23(22)32-26(30)25(24)28-20/h5-7,9,11-13,16-17H,3-4,8,10,14-15,18H2,1-2H3 |
| InChIKey | ZTMXLZCSSICVKT-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|