C17H17NO4S — CID 22334383
N-(3-ethoxypropyl)-4-oxothieno[3,2-c]chromene-2-carboxamide (PubChem CID 22334383) has the molecular formula C17H17NO4S and a molecular weight of 331.39 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-4-oxothieno[3,2-c]chromene-2-carboxamide.
| Compound Name | N-(3-ethoxypropyl)-4-oxothieno[3,2-c]chromene-2-carboxamide |
|---|---|
| PubChem CID | 22334383 |
| Molecular Formula | C17H17NO4S |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | N-(3-ethoxypropyl)-4-oxothieno[3,2-c]chromene-2-carboxamide |
| SMILES | CCOCCCNC(=O)c1cc2c(=O)oc3ccccc3c2s1 |
| InChI | InChI=1S/C17H17NO4S/c1-2-21-9-5-8-18-16(19)14-10-12-15(23-14)11-6-3-4-7-13(11)22-17(12)20/h3-4,6-7,10H,2,5,8-9H2,1H3,(H,18,19) |
| InChIKey | KOIOIVRJWMOFDE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|