C22H19NO3S — CID 20865578
8-methyl-N-[2-(3-methylphenyl)ethyl]-4-oxothieno[3,2-c]chromene-2-carboxamide (PubChem CID 20865578) has the molecular formula C22H19NO3S and a molecular weight of 377.47 g/mol. Its IUPAC name is 8-methyl-N-[2-(3-methylphenyl)ethyl]-4-oxothieno[3,2-c]chromene-2-carboxamide.
| Compound Name | 8-methyl-N-[2-(3-methylphenyl)ethyl]-4-oxothieno[3,2-c]chromene-2-carboxamide |
|---|---|
| PubChem CID | 20865578 |
| Molecular Formula | C22H19NO3S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 8-methyl-N-[2-(3-methylphenyl)ethyl]-4-oxothieno[3,2-c]chromene-2-carboxamide |
| SMILES | Cc1cccc(CCNC(=O)c2cc3c(=O)oc4ccc(C)cc4c3s2)c1 |
| InChI | InChI=1S/C22H19NO3S/c1-13-4-3-5-15(10-13)8-9-23-21(24)19-12-17-20(27-19)16-11-14(2)6-7-18(16)26-22(17)25/h3-7,10-12H,8-9H2,1-2H3,(H,23,24) |
| InChIKey | KNEXMBJNMREASN-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|