C25H23NO3S — CID 20865567
8-methyl-4-oxo-N-[(1-phenylcyclopentyl)methyl]thieno[3,2-c]chromene-2-carboxamide (PubChem CID 20865567) has the molecular formula C25H23NO3S and a molecular weight of 417.53 g/mol. Its IUPAC name is 8-methyl-4-oxo-N-[(1-phenylcyclopentyl)methyl]thieno[3,2-c]chromene-2-carboxamide.
| Compound Name | 8-methyl-4-oxo-N-[(1-phenylcyclopentyl)methyl]thieno[3,2-c]chromene-2-carboxamide |
|---|---|
| PubChem CID | 20865567 |
| Molecular Formula | C25H23NO3S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 8-methyl-4-oxo-N-[(1-phenylcyclopentyl)methyl]thieno[3,2-c]chromene-2-carboxamide |
| SMILES | Cc1ccc2oc(=O)c3cc(C(=O)NCC4(c5ccccc5)CCCC4)sc3c2c1 |
| InChI | InChI=1S/C25H23NO3S/c1-16-9-10-20-18(13-16)22-19(24(28)29-20)14-21(30-22)23(27)26-15-25(11-5-6-12-25)17-7-3-2-4-8-17/h2-4,7-10,13-14H,5-6,11-12,15H2,1H3,(H,26,27) |
| InChIKey | DKZQFTKPDSWLKO-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|