C20H17NO3 — CID 42145626
2-oxo-N-[(1-phenylcyclopropyl)methyl]chromene-3-carboxamide (PubChem CID 42145626) has the molecular formula C20H17NO3 and a molecular weight of 319.36 g/mol. Its IUPAC name is 2-oxo-N-[(1-phenylcyclopropyl)methyl]chromene-3-carboxamide.
| Compound Name | 2-oxo-N-[(1-phenylcyclopropyl)methyl]chromene-3-carboxamide |
|---|---|
| PubChem CID | 42145626 |
| Molecular Formula | C20H17NO3 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 2-oxo-N-[(1-phenylcyclopropyl)methyl]chromene-3-carboxamide |
| SMILES | O=C(NCC1(c2ccccc2)CC1)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C20H17NO3/c22-18(16-12-14-6-4-5-9-17(14)24-19(16)23)21-13-20(10-11-20)15-7-2-1-3-8-15/h1-9,12H,10-11,13H2,(H,21,22) |
| InChIKey | FQVGDOLHWKUTJN-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|