C30H30N2O6 — CID 25387928
2-oxo-N-[[(1R,5S)-1,3,3-trimethyl-5-[(2-oxochromene-3-carbonyl)amino]cyclohexyl]methyl]chromene-3-carboxamide (PubChem CID 25387928) has the molecular formula C30H30N2O6 and a molecular weight of 514.58 g/mol. Its IUPAC name is 2-oxo-N-[[(1R,5S)-1,3,3-trimethyl-5-[(2-oxochromene-3-carbonyl)amino]cyclohexyl]methyl]chromene-3-carboxamide.
| Compound Name | 2-oxo-N-[[(1R,5S)-1,3,3-trimethyl-5-[(2-oxochromene-3-carbonyl)amino]cyclohexyl]methyl]chromene-3-carboxamide |
|---|---|
| PubChem CID | 25387928 |
| Molecular Formula | C30H30N2O6 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | 2-oxo-N-[[(1R,5S)-1,3,3-trimethyl-5-[(2-oxochromene-3-carbonyl)amino]cyclohexyl]methyl]chromene-3-carboxamide |
| SMILES | CC1(C)C[C@H](NC(=O)c2cc3ccccc3oc2=O)C[C@](C)(CNC(=O)c2cc3ccccc3oc2=O)C1 |
| InChI | InChI=1S/C30H30N2O6/c1-29(2)14-20(32-26(34)22-13-19-9-5-7-11-24(19)38-28(22)36)15-30(3,16-29)17-31-25(33)21-12-18-8-4-6-10-23(18)37-27(21)35/h4-13,20H,14-17H2,1-3H3,(H,31,33)(H,32,34)/t20-,30-/m0/s1 |
| InChIKey | KIDYVYCXLARYHV-WRGVRERRSA-N |
| XLogP | 4.64 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|