C13H10FNO3 — CID 110486348
N-cyclopropyl-7-fluoro-2-oxochromene-3-carboxamide (PubChem CID 110486348) has the molecular formula C13H10FNO3 and a molecular weight of 247.22 g/mol. Its IUPAC name is N-cyclopropyl-7-fluoro-2-oxochromene-3-carboxamide.
| Compound Name | N-cyclopropyl-7-fluoro-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 110486348 |
| Molecular Formula | C13H10FNO3 |
| Molecular Weight | 247.22 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | N-cyclopropyl-7-fluoro-2-oxochromene-3-carboxamide |
| SMILES | O=C(NC1CC1)c1cc2ccc(F)cc2oc1=O |
| InChI | InChI=1S/C13H10FNO3/c14-8-2-1-7-5-10(12(16)15-9-3-4-9)13(17)18-11(7)6-8/h1-2,5-6,9H,3-4H2,(H,15,16) |
| InChIKey | CSOPCFFJBBVNSF-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.22 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|