C21H17FN2O2 — CID 175071097
N-cyclopropyl-1-[(6-fluoro-1-benzofuran-2-yl)methyl]indole-7-carboxamide (PubChem CID 175071097) has the molecular formula C21H17FN2O2 and a molecular weight of 348.38 g/mol. Its IUPAC name is N-cyclopropyl-1-[(6-fluoro-1-benzofuran-2-yl)methyl]indole-7-carboxamide.
| Compound Name | N-cyclopropyl-1-[(6-fluoro-1-benzofuran-2-yl)methyl]indole-7-carboxamide |
|---|---|
| PubChem CID | 175071097 |
| Molecular Formula | C21H17FN2O2 |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | N-cyclopropyl-1-[(6-fluoro-1-benzofuran-2-yl)methyl]indole-7-carboxamide |
| SMILES | O=C(NC1CC1)c1cccc2ccn(Cc3cc4ccc(F)cc4o3)c12 |
| InChI | InChI=1S/C21H17FN2O2/c22-15-5-4-14-10-17(26-19(14)11-15)12-24-9-8-13-2-1-3-18(20(13)24)21(25)23-16-6-7-16/h1-5,8-11,16H,6-7,12H2,(H,23,25) |
| InChIKey | VUKOGCNXJXUSQM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 47.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |