C19H12BrNO3S — CID 22310643
N-(2-bromo-4-methylphenyl)-4-oxothieno[3,2-c]chromene-2-carboxamide (PubChem CID 22310643) has the molecular formula C19H12BrNO3S and a molecular weight of 414.28 g/mol. Its IUPAC name is N-(2-bromo-4-methylphenyl)-4-oxothieno[3,2-c]chromene-2-carboxamide.
| Compound Name | N-(2-bromo-4-methylphenyl)-4-oxothieno[3,2-c]chromene-2-carboxamide |
|---|---|
| PubChem CID | 22310643 |
| Molecular Formula | C19H12BrNO3S |
| Molecular Weight | 414.28 g/mol |
| Exact Mass | 412.97 |
| IUPAC Name | N-(2-bromo-4-methylphenyl)-4-oxothieno[3,2-c]chromene-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cc3c(=O)oc4ccccc4c3s2)c(Br)c1 |
| InChI | InChI=1S/C19H12BrNO3S/c1-10-6-7-14(13(20)8-10)21-18(22)16-9-12-17(25-16)11-4-2-3-5-15(11)24-19(12)23/h2-9H,1H3,(H,21,22) |
| InChIKey | NUDOMVZMUDWBSY-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.28 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|