C18H12N2O3S — CID 23827885
N-(6-methyl-2-pyridinyl)-4-oxothieno[3,2-c]chromene-2-carboxamide (PubChem CID 23827885) has the molecular formula C18H12N2O3S and a molecular weight of 336.37 g/mol. Its IUPAC name is N-(6-methyl-2-pyridinyl)-4-oxothieno[3,2-c]chromene-2-carboxamide.
| Compound Name | N-(6-methyl-2-pyridinyl)-4-oxothieno[3,2-c]chromene-2-carboxamide |
|---|---|
| PubChem CID | 23827885 |
| Molecular Formula | C18H12N2O3S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | N-(6-methyl-2-pyridinyl)-4-oxothieno[3,2-c]chromene-2-carboxamide |
| SMILES | Cc1cccc(NC(=O)c2cc3c(=O)oc4ccccc4c3s2)n1 |
| InChI | InChI=1S/C18H12N2O3S/c1-10-5-4-8-15(19-10)20-17(21)14-9-12-16(24-14)11-6-2-3-7-13(11)23-18(12)22/h2-9H,1H3,(H,19,20,21) |
| InChIKey | UQTSBIRBARSEOT-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|