C20H12F3NO3S — CID 15997027
N-methyl-4-oxo-N-[3-(trifluoromethyl)phenyl]thieno[3,2-c]chromene-2-carboxamide (PubChem CID 15997027) has the molecular formula C20H12F3NO3S and a molecular weight of 403.38 g/mol. Its IUPAC name is N-methyl-4-oxo-N-[3-(trifluoromethyl)phenyl]thieno[3,2-c]chromene-2-carboxamide.
| Compound Name | N-methyl-4-oxo-N-[3-(trifluoromethyl)phenyl]thieno[3,2-c]chromene-2-carboxamide |
|---|---|
| PubChem CID | 15997027 |
| Molecular Formula | C20H12F3NO3S |
| Molecular Weight | 403.38 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | N-methyl-4-oxo-N-[3-(trifluoromethyl)phenyl]thieno[3,2-c]chromene-2-carboxamide |
| SMILES | CN(C(=O)c1cc2c(=O)oc3ccccc3c2s1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H12F3NO3S/c1-24(12-6-4-5-11(9-12)20(21,22)23)18(25)16-10-14-17(28-16)13-7-2-3-8-15(13)27-19(14)26/h2-10H,1H3 |
| InChIKey | NKDCVPBMXZZJIV-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.38 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|