C15H10Cl2F3NO — CID 1475846
3,5-dichloro-N-methyl-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 1475846) has the molecular formula C15H10Cl2F3NO and a molecular weight of 348.15 g/mol. Its IUPAC name is 3,5-dichloro-N-methyl-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3,5-dichloro-N-methyl-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 1475846 |
| Molecular Formula | C15H10Cl2F3NO |
| Molecular Weight | 348.15 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | 3,5-dichloro-N-methyl-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | CN(C(=O)c1cc(Cl)cc(Cl)c1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H10Cl2F3NO/c1-21(13-4-2-3-10(7-13)15(18,19)20)14(22)9-5-11(16)8-12(17)6-9/h2-8H,1H3 |
| InChIKey | IEHYALRCUSGEOZ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.15 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |