C18H23Cl2NO — CID 156791859
3,5-dichloro-N-methyl-N-phenylbenzamide;ethane (PubChem CID 156791859) has the molecular formula C18H23Cl2NO and a molecular weight of 340.29 g/mol. Its IUPAC name is 3,5-dichloro-N-methyl-N-phenylbenzamide;ethane.
| Compound Name | 3,5-dichloro-N-methyl-N-phenylbenzamide;ethane |
|---|---|
| PubChem CID | 156791859 |
| Molecular Formula | C18H23Cl2NO |
| Molecular Weight | 340.29 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 3,5-dichloro-N-methyl-N-phenylbenzamide;ethane |
| SMILES | CC.CC.CN(C(=O)c1cc(Cl)cc(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C14H11Cl2NO.2C2H6/c1-17(13-5-3-2-4-6-13)14(18)10-7-11(15)9-12(16)8-10;2*1-2/h2-9H,1H3;2*1-2H3 |
| InChIKey | XIXOTVHDUJRSPY-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.29 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |