C14H10N2O2 — CID 154732245
2-cyclopropylchromeno[4,3-d]pyrimidin-5-one (PubChem CID 154732245) has the molecular formula C14H10N2O2 and a molecular weight of 238.25 g/mol. Its IUPAC name is 2-cyclopropylchromeno[4,3-d]pyrimidin-5-one.
| Compound Name | 2-cyclopropylchromeno[4,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 154732245 |
| Molecular Formula | C14H10N2O2 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 2-cyclopropylchromeno[4,3-d]pyrimidin-5-one |
| SMILES | O=c1oc2ccccc2c2nc(C3CC3)ncc12 |
| InChI | InChI=1S/C14H10N2O2/c17-14-10-7-15-13(8-5-6-8)16-12(10)9-3-1-2-4-11(9)18-14/h1-4,7-8H,5-6H2 |
| InChIKey | PHRQYVRVSHFNEB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|