C20H17Cl2N3O2 — CID 24912722
4,6-dichloro-3-[(2-cyclopropyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)methyl]chromen-2-one (PubChem CID 24912722) has the molecular formula C20H17Cl2N3O2 and a molecular weight of 402.28 g/mol. Its IUPAC name is 4,6-dichloro-3-[(2-cyclopropyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)methyl]chromen-2-one.
| Compound Name | 4,6-dichloro-3-[(2-cyclopropyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)methyl]chromen-2-one |
|---|---|
| PubChem CID | 24912722 |
| Molecular Formula | C20H17Cl2N3O2 |
| Molecular Weight | 402.28 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | 4,6-dichloro-3-[(2-cyclopropyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)methyl]chromen-2-one |
| SMILES | O=c1oc2ccc(Cl)cc2c(Cl)c1CN1CCc2nc(C3CC3)ncc2C1 |
| InChI | InChI=1S/C20H17Cl2N3O2/c21-13-3-4-17-14(7-13)18(22)15(20(26)27-17)10-25-6-5-16-12(9-25)8-23-19(24-16)11-1-2-11/h3-4,7-8,11H,1-2,5-6,9-10H2 |
| InChIKey | CXEGMJXNWWXNHD-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.28 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|