C21H20ClN3O2 — CID 24912743
4-chloro-3-[(2-cyclopropyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)methyl]-6-methylchromen-2-one (PubChem CID 24912743) has the molecular formula C21H20ClN3O2 and a molecular weight of 381.86 g/mol. Its IUPAC name is 4-chloro-3-[(2-cyclopropyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)methyl]-6-methylchromen-2-one.
| Compound Name | 4-chloro-3-[(2-cyclopropyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)methyl]-6-methylchromen-2-one |
|---|---|
| PubChem CID | 24912743 |
| Molecular Formula | C21H20ClN3O2 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 4-chloro-3-[(2-cyclopropyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)methyl]-6-methylchromen-2-one |
| SMILES | Cc1ccc2oc(=O)c(CN3CCc4nc(C5CC5)ncc4C3)c(Cl)c2c1 |
| InChI | InChI=1S/C21H20ClN3O2/c1-12-2-5-18-15(8-12)19(22)16(21(26)27-18)11-25-7-6-17-14(10-25)9-23-20(24-17)13-3-4-13/h2,5,8-9,13H,3-4,6-7,10-11H2,1H3 |
| InChIKey | SHBJYFMHGHYXBT-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|