C18H13ClF3N3O2 — CID 24910359
4-chloro-3-[[2-(trifluoromethyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]methyl]chromen-2-one (PubChem CID 24910359) has the molecular formula C18H13ClF3N3O2 and a molecular weight of 395.77 g/mol. Its IUPAC name is 4-chloro-3-[[2-(trifluoromethyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]methyl]chromen-2-one.
| Compound Name | 4-chloro-3-[[2-(trifluoromethyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]methyl]chromen-2-one |
|---|---|
| PubChem CID | 24910359 |
| Molecular Formula | C18H13ClF3N3O2 |
| Molecular Weight | 395.77 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | 4-chloro-3-[[2-(trifluoromethyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]methyl]chromen-2-one |
| SMILES | O=c1oc2ccccc2c(Cl)c1CN1CCc2nc(C(F)(F)F)ncc2C1 |
| InChI | InChI=1S/C18H13ClF3N3O2/c19-15-11-3-1-2-4-14(11)27-16(26)12(15)9-25-6-5-13-10(8-25)7-23-17(24-13)18(20,21)22/h1-4,7H,5-6,8-9H2 |
| InChIKey | IMFBSEREYLBMBF-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.77 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|