C22H18ClN3O2S — CID 24912748
4-chloro-6-methyl-3-[(2-thiophen-2-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)methyl]chromen-2-one (PubChem CID 24912748) has the molecular formula C22H18ClN3O2S and a molecular weight of 423.93 g/mol. Its IUPAC name is 4-chloro-6-methyl-3-[(2-thiophen-2-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)methyl]chromen-2-one.
| Compound Name | 4-chloro-6-methyl-3-[(2-thiophen-2-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)methyl]chromen-2-one |
|---|---|
| PubChem CID | 24912748 |
| Molecular Formula | C22H18ClN3O2S |
| Molecular Weight | 423.93 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | 4-chloro-6-methyl-3-[(2-thiophen-2-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)methyl]chromen-2-one |
| SMILES | Cc1ccc2oc(=O)c(CN3CCc4nc(-c5cccs5)ncc4C3)c(Cl)c2c1 |
| InChI | InChI=1S/C22H18ClN3O2S/c1-13-4-5-18-15(9-13)20(23)16(22(27)28-18)12-26-7-6-17-14(11-26)10-24-21(25-17)19-3-2-8-29-19/h2-5,8-10H,6-7,11-12H2,1H3 |
| InChIKey | HXDYMIQPIJOJNZ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.93 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|