C26H14N2O4 — CID 177476911
11,27-dioxa-3,19-diazaheptacyclo[16.12.0.02,15.04,13.05,10.020,29.021,26]triaconta-1(18),2,4(13),5,7,9,14,19,21,23,25,29-dodecaene-12,28-dione (PubChem CID 177476911) has the molecular formula C26H14N2O4 and a molecular weight of 418.41 g/mol. Its IUPAC name is 11,27-dioxa-3,19-diazaheptacyclo[16.12.0.02,15.04,13.05,10.020,29.021,26]triaconta-1(18),2,4(13),5,7,9,14,19,21,23,25,29-dodecaene-12,28-dione.
| Compound Name | 11,27-dioxa-3,19-diazaheptacyclo[16.12.0.02,15.04,13.05,10.020,29.021,26]triaconta-1(18),2,4(13),5,7,9,14,19,21,23,25,29-dodecaene-12,28-dione |
|---|---|
| PubChem CID | 177476911 |
| Molecular Formula | C26H14N2O4 |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 11,27-dioxa-3,19-diazaheptacyclo[16.12.0.02,15.04,13.05,10.020,29.021,26]triaconta-1(18),2,4(13),5,7,9,14,19,21,23,25,29-dodecaene-12,28-dione |
| SMILES | O=c1oc2ccccc2c2nc3c(cc12)-c1nc2c(cc1CC3)c(=O)oc1ccccc12 |
| InChI | InChI=1S/C26H14N2O4/c29-25-17-11-13-9-10-19-16(22(13)28-24(17)15-6-2-4-8-21(15)31-25)12-18-23(27-19)14-5-1-3-7-20(14)32-26(18)30/h1-8,11-12H,9-10H2 |
| InChIKey | OXGCTHDDQPZUJO-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 86.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|