C22H14ClNO3 — CID 171351726
7-(2-chlorophenyl)-10,11-dihydro-9H-chromeno[4,3-b]quinoline-6,8-dione (PubChem CID 171351726) has the molecular formula C22H14ClNO3 and a molecular weight of 375.81 g/mol. Its IUPAC name is 7-(2-chlorophenyl)-10,11-dihydro-9H-chromeno[4,3-b]quinoline-6,8-dione.
| Compound Name | 7-(2-chlorophenyl)-10,11-dihydro-9H-chromeno[4,3-b]quinoline-6,8-dione |
|---|---|
| PubChem CID | 171351726 |
| Molecular Formula | C22H14ClNO3 |
| Molecular Weight | 375.81 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | 7-(2-chlorophenyl)-10,11-dihydro-9H-chromeno[4,3-b]quinoline-6,8-dione |
| SMILES | O=C1CCCc2nc3c(c(-c4ccccc4Cl)c21)c(=O)oc1ccccc13 |
| InChI | InChI=1S/C22H14ClNO3/c23-14-8-3-1-6-12(14)18-19-15(9-5-10-16(19)25)24-21-13-7-2-4-11-17(13)27-22(26)20(18)21/h1-4,6-8,11H,5,9-10H2 |
| InChIKey | YLOJGDTYUWNABY-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.81 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|