C13H12N2O2 — CID 54496209
9-(hydroxyamino)-3,4-dihydro-2H-acridin-1-one (PubChem CID 54496209) has the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. Its IUPAC name is 9-(hydroxyamino)-3,4-dihydro-2H-acridin-1-one.
| Compound Name | 9-(hydroxyamino)-3,4-dihydro-2H-acridin-1-one |
|---|---|
| PubChem CID | 54496209 |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 9-(hydroxyamino)-3,4-dihydro-2H-acridin-1-one |
| SMILES | O=C1CCCc2nc3ccccc3c(NO)c21 |
| InChI | InChI=1S/C13H12N2O2/c16-11-7-3-6-10-12(11)13(15-17)8-4-1-2-5-9(8)14-10/h1-2,4-5,17H,3,6-7H2,(H,14,15) |
| InChIKey | XZHKANYXJRIUPA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|