C12H8O4 — CID 13308848
3-(hydroxymethyl)pyrano[3,2-b][1]benzofuran-4-one (PubChem CID 13308848) has the molecular formula C12H8O4 and a molecular weight of 216.19 g/mol. Its IUPAC name is 3-(hydroxymethyl)pyrano[3,2-b][1]benzofuran-4-one.
| Compound Name | 3-(hydroxymethyl)pyrano[3,2-b][1]benzofuran-4-one |
|---|---|
| PubChem CID | 13308848 |
| Molecular Formula | C12H8O4 |
| Molecular Weight | 216.19 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | 3-(hydroxymethyl)pyrano[3,2-b][1]benzofuran-4-one |
| SMILES | O=c1c(CO)coc2c1oc1ccccc12 |
| InChI | InChI=1S/C12H8O4/c13-5-7-6-15-11-8-3-1-2-4-9(8)16-12(11)10(7)14/h1-4,6,13H,5H2 |
| InChIKey | CZGANMAKBFYHBB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.19 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |