About 4-hydroxy-2,5-dioxopyrano[3,2-c]chromene-3-carboxamide
4-hydroxy-2,5-dioxopyrano[3,2-c]chromene-3-carboxamide (PubChem CID 102329972) has the molecular formula C13H7NO6
and a molecular weight of 273.20 g/mol. Its IUPAC name is 4-hydroxy-2,5-dioxopyrano[3,2-c]chromene-3-carboxamide.
Molecular Properties
| Compound Name | 4-hydroxy-2,5-dioxopyrano[3,2-c]chromene-3-carboxamide |
| PubChem CID | 102329972 |
| Molecular Formula | C13H7NO6 |
| Molecular Weight | 273.20 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | 4-hydroxy-2,5-dioxopyrano[3,2-c]chromene-3-carboxamide |
| SMILES | NC(=O)c1c(O)c2c(=O)oc3ccccc3c2oc1=O |
| InChI | InChI=1S/C13H7NO6/c14-11(16)8-9(15)7-10(20-13(8)18)5-3-1-2-4-6(5)19-12(7)17/h1-4,15H,(H2,14,16) |
| InChIKey | CHLXCBAUAHHLRN-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 123.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.20 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-2,5-dioxopyrano[3,2-c]chromene-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-2,5-dioxopyrano[3,2-c]chromene-3-carboxamide?
The IUPAC name of 4-hydroxy-2,5-dioxopyrano[3,2-c]chromene-3-carboxamide (CID 102329972) is 4-hydroxy-2,5-dioxopyrano[3,2-c]chromene-3-carboxamide.
What is the SMILES notation for 4-hydroxy-2,5-dioxopyrano[3,2-c]chromene-3-carboxamide?
The canonical SMILES for 4-hydroxy-2,5-dioxopyrano[3,2-c]chromene-3-carboxamide is NC(=O)c1c(O)c2c(=O)oc3ccccc3c2oc1=O.
What is the InChIKey of 4-hydroxy-2,5-dioxopyrano[3,2-c]chromene-3-carboxamide?
The InChIKey is CHLXCBAUAHHLRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7NO6/c14-11(16)8-9(15)7-10(20-13(8)18)5-3-1-2-4-6(5)19-12(7)17/h1-4,15H,(H2,14,16).
What are the key properties of 4-hydroxy-2,5-dioxopyrano[3,2-c]chromene-3-carboxamide?
4-hydroxy-2,5-dioxopyrano[3,2-c]chromene-3-carboxamide has a molecular weight of 273.20 g/mol, XLogP of 0.70, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-2,5-dioxopyrano[3,2-c]chromene-3-carboxamide is sourced from PubChem (CID 102329972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).