C20H13ClN2O3 — CID 5152683
3-chloro-N-(4-methyl-5-oxochromeno[4,3-b]pyridin-2-yl)benzamide (PubChem CID 5152683) has the molecular formula C20H13ClN2O3 and a molecular weight of 364.79 g/mol. Its IUPAC name is 3-chloro-N-(4-methyl-5-oxochromeno[4,3-b]pyridin-2-yl)benzamide.
| Compound Name | 3-chloro-N-(4-methyl-5-oxochromeno[4,3-b]pyridin-2-yl)benzamide |
|---|---|
| PubChem CID | 5152683 |
| Molecular Formula | C20H13ClN2O3 |
| Molecular Weight | 364.79 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | 3-chloro-N-(4-methyl-5-oxochromeno[4,3-b]pyridin-2-yl)benzamide |
| SMILES | Cc1cc(NC(=O)c2cccc(Cl)c2)nc2c1c(=O)oc1ccccc12 |
| InChI | InChI=1S/C20H13ClN2O3/c1-11-9-16(23-19(24)12-5-4-6-13(21)10-12)22-18-14-7-2-3-8-15(14)26-20(25)17(11)18/h2-10H,1H3,(H,22,23,24) |
| InChIKey | QDEOHWNCYMPRTI-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.79 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|