C20H19N3O5S — CID 1307730
4-morpholin-4-yl-4-oxo-N-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]butanamide (PubChem CID 1307730) has the molecular formula C20H19N3O5S and a molecular weight of 413.46 g/mol. Its IUPAC name is 4-morpholin-4-yl-4-oxo-N-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]butanamide.
| Compound Name | 4-morpholin-4-yl-4-oxo-N-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 1307730 |
| Molecular Formula | C20H19N3O5S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 4-morpholin-4-yl-4-oxo-N-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]butanamide |
| SMILES | O=C(CCC(=O)N1CCOCC1)Nc1nc(-c2cc3ccccc3oc2=O)cs1 |
| InChI | InChI=1S/C20H19N3O5S/c24-17(5-6-18(25)23-7-9-27-10-8-23)22-20-21-15(12-29-20)14-11-13-3-1-2-4-16(13)28-19(14)26/h1-4,11-12H,5-10H2,(H,21,22,24) |
| InChIKey | BEAPKGKOTBZPKO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|