C20H12N2O4S — CID 3776365
3-[2-[(3-oxo-1H-2-benzofuran-1-yl)amino]-1,3-thiazol-4-yl]chromen-2-one (PubChem CID 3776365) has the molecular formula C20H12N2O4S and a molecular weight of 376.39 g/mol. Its IUPAC name is 3-[2-[(3-oxo-1H-2-benzofuran-1-yl)amino]-1,3-thiazol-4-yl]chromen-2-one.
| Compound Name | 3-[2-[(3-oxo-1H-2-benzofuran-1-yl)amino]-1,3-thiazol-4-yl]chromen-2-one |
|---|---|
| PubChem CID | 3776365 |
| Molecular Formula | C20H12N2O4S |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | 3-[2-[(3-oxo-1H-2-benzofuran-1-yl)amino]-1,3-thiazol-4-yl]chromen-2-one |
| SMILES | O=C1OC(Nc2nc(-c3cc4ccccc4oc3=O)cs2)c2ccccc21 |
| InChI | InChI=1S/C20H12N2O4S/c23-18-13-7-3-2-6-12(13)17(26-18)22-20-21-15(10-27-20)14-9-11-5-1-4-8-16(11)25-19(14)24/h1-10,17H,(H,21,22) |
| InChIKey | FMWADKRWESZYGC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|