C14H16N2O2S — CID 126627632
4-[2-(pent-1-en-2-ylamino)-1,3-thiazol-4-yl]benzene-1,3-diol (PubChem CID 126627632) has the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. Its IUPAC name is 4-[2-(pent-1-en-2-ylamino)-1,3-thiazol-4-yl]benzene-1,3-diol.
| Compound Name | 4-[2-(pent-1-en-2-ylamino)-1,3-thiazol-4-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 126627632 |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 4-[2-(pent-1-en-2-ylamino)-1,3-thiazol-4-yl]benzene-1,3-diol |
| SMILES | C=C(CCC)Nc1nc(-c2ccc(O)cc2O)cs1 |
| InChI | InChI=1S/C14H16N2O2S/c1-3-4-9(2)15-14-16-12(8-19-14)11-6-5-10(17)7-13(11)18/h5-8,17-18H,2-4H2,1H3,(H,15,16) |
| InChIKey | HORKNDGEUHEYFW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |